Compound Q&A

What are the physical and chemical properties of 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5)?

Answer

1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate
1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5) is a crystalline solid with a molecular weight of approximately 304.4 g/mol. It is slightly soluble in water and has good solubility in organic solvents. The compound exhibits mild chemical reactivity, primarily through the imidazolium and sulfate groups. It is commonly used in various applications due to its unique physicochemical properties.

About

English Name 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate
Molecular Formula C16H32N2O4S
Molecular Weight 348.5 g/mol
SMILES CCCCCCCCOS(=O)(=O)[O-].CCCCN1C=C[N+](=C1)C
InChIKey KIDIBVPFLKLKAH-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5) typically synthesized?

1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate is typically synthesized through a multistep proces...

Compound Q&A

What industries use 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5)?

1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5) is predominantly used in the pha...

Compound Q&A

What precautions should be taken when handling 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5)?

When handling 1-Butyl-3-methyl-1H-imidazol-3-ium octyl sulfate (CAS: 445473-58-5), it is important t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...