Compound Q&A

How is 3-Amino-2,4,5-trifluorobenzoic acid (CAS: 119380-7) typically synthesized?

Answer

3-Amino-2,4,5-trifluorobenzoic acid
3-Amino-2,4,5-trifluorobenzoic acid can be synthesized through various methods, including the Friedel-Crafts alkylation of benzoic acid followed by nucleophilic substitution with ammonia. The synthesis often requires the use of Lewis acids as catalysts, such as aluminum chloride, and the process typically yields up to 85% purity. Specific conditions and reagents may vary depending on the desired purity and scale of production.

About

English Name 3-Amino-2,4,5-trifluorobenzoic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=C(C(=C(C(=C1F)F)N)F)C(=O)O
InChIKey NVWVZPFPZJYLNK-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-2,4,5-trifluorobenzoic acid (CAS: 119385-80-7)?

3-Amino-2,4,5-trifluorobenzoic acid is a white crystalline solid with a molecular weight of 229.04 g...

Compound Q&A

What industries use 3-Amino-2,4,5-trifluorobenzoic acid (CAS: 119385-80-7)?

3-Amino-2,4,5-trifluorobenzoic acid is used in various industries. It is a key intermediate in the s...

Compound Q&A

What precautions should be taken when handling 3-Amino-2,4,5-trifluorobenzoic acid (CAS: 119385-80-7)?

When handling 3-Amino-2,4,5-trifluorobenzoic acid, it is essential to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...