Compound Q&A

What are the physical and chemical properties of 3-Amino-2,4,5-trifluorobenzoic acid (CAS: 119385-80-7)?

Answer

3-Amino-2,4,5-trifluorobenzoic acid
3-Amino-2,4,5-trifluorobenzoic acid is a white crystalline solid with a molecular weight of 229.04 g/mol. It is slightly soluble in water and more soluble in organic solvents. The compound is moderately reactive due to the presence of functional groups such as the carboxylic acid and amino groups. It exhibits weak basic and acidic properties, and its reactivity can be influenced by the presence of fluorine atoms, which enhance its polarity and solubility.

About

English Name 3-Amino-2,4,5-trifluorobenzoic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=C(C(=C(C(=C1F)F)N)F)C(=O)O
InChIKey NVWVZPFPZJYLNK-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 3-Amino-2,4,5-trifluorobenzoic acid (CAS: 119380-7) typically synthesized?

3-Amino-2,4,5-trifluorobenzoic acid can be synthesized through various methods, including the Friede...

Compound Q&A

What industries use 3-Amino-2,4,5-trifluorobenzoic acid (CAS: 119385-80-7)?

3-Amino-2,4,5-trifluorobenzoic acid is used in various industries. It is a key intermediate in the s...

Compound Q&A

What precautions should be taken when handling 3-Amino-2,4,5-trifluorobenzoic acid (CAS: 119385-80-7)?

When handling 3-Amino-2,4,5-trifluorobenzoic acid, it is essential to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...