Compound Q&A

What industries use 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5)?

Answer

3-(3-Chlorophenoxy)propanoic acid
3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5) is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It is also utilized in the production of certain pesticides and herbicides due to its chlorophenoxy functionality. Additionally, it has applications in the polymer industry for enhancing the properties of certain polymers.

About

CAS No 7170-50-5
English Name 3-(3-Chlorophenoxy)propanoic acid
Molecular Formula C9H9ClO3
Molecular Weight 200.62 g/mol
SMILES C1=CC(=CC(=C1)Cl)OCCC(=O)O
InChIKey QSGKVNYPPAQLDO-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5)?

3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5) typically synthesized?

3-(3-Chlorophenoxy)propanoic acid is typically synthesized by reacting 3-chlorophenol with propanoyl...

Compound Q&A

What precautions should be taken when handling 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5)?

When handling 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5), ensure the use of chemical-resista...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...