Compound Q&A

How is 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5) typically synthesized?

Answer

3-(3-Chlorophenoxy)propanoic acid
3-(3-Chlorophenoxy)propanoic acid is typically synthesized by reacting 3-chlorophenol with propanoyl chloride in the presence of a base such as sodium hydroxide. The reaction is conducted at room temperature and provides a yield of about 75-80%. The product is then purified by recrystallization from ethanol.

About

CAS No 7170-50-5
English Name 3-(3-Chlorophenoxy)propanoic acid
Molecular Formula C9H9ClO3
Molecular Weight 200.62 g/mol
SMILES C1=CC(=CC(=C1)Cl)OCCC(=O)O
InChIKey QSGKVNYPPAQLDO-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5)?

3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5)?

3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5)?

When handling 3-(3-Chlorophenoxy)propanoic acid (CAS: 7170-50-5), ensure the use of chemical-resista...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...