Compound Q&A

What are the physical and chemical properties of Tetraphenylthiophene (CAS: 1884-68-0)?

Answer

Tetraphenylthiophene
Tetraphenylthiophene (CAS: 1884-68-0) is a crystalline solid with a molecular weight of approximately 262.33 g/mol. It has a high solubility in non-polar solvents such as toluene and chlorobenzene, but is insoluble in water. Chemically, it is relatively stable under normal conditions but can undergo substitution reactions under certain conditions. It has a molar mass of 262.33 g/mol and a melting point of 194-196°C.

About

CAS No 1884-68-0
English Name Tetraphenylthiophene
Molecular Formula C28H20S
Molecular Weight 388.535 g/mol
SMILES C1=CC=C(C=C1)C2=C(SC(=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5
InChIKey MQFBWJOMLIHUDY-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Tetraphenylthiophene (CAS: 1884-68-0) typically synthesized?

Tetraphenylthiophene (CAS: 1884-68-0) is commonly synthesized via the Friedel-Crafts alkylation of t...

Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key intermediate in the...

Compound Q&A

What precautions should be taken when handling Tetraphenylthiophene (CAS: 1884-68-0)?

When handling Tetraphenylthiophene (CAS: 1884-68-0), appropriate personal protective equipment (PPE)...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene