Compound Q&A

What industries use 3-Bromo-1-(phenylsulfonyl)-1H-indole (CAS: 99655-68-2)?

Answer

3-Bromo-1-(phenylsulfonyl)-1H-indole
3-Bromo-1-(phenylsulfonyl)-1H-indole (CAS: 99655-68-2) is primarily used in the pharmaceutical industry for the synthesis of various bioactive molecules. It has potential applications in the development of new drugs targeting specific biological pathways. Additionally, it may have applications in the polymer industry for the modification of polymer properties.

About

CAS No 99655-68-2
English Name 3-Bromo-1-(phenylsulfonyl)-1H-indole
Molecular Formula C14H10BrNO2S
Molecular Weight 336.21 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)Br
InChIKey MXPFKHHDXIJNDX-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-1-(phenylsulfonyl)-1H-indole (CAS: 99655-68-2)?

3-Bromo-1-(phenylsulfonyl)-1H-indole (CAS: 99655-68-2) is a crystalline compound with a molecular we...

Compound Q&A

How is 3-Bromo-1-(phenylsulfonyl)-1H-indole (CAS: 99655-68-2) typically synthesized?

3-Bromo-1-(phenylsulfonyl)-1H-indole is typically synthesized via a multi-step process. The first st...

Compound Q&A

What precautions should be taken when handling 3-Bromo-1-(phenylsulfonyl)-1H-indole (CAS: 99655-68-2)?

When handling 3-Bromo-1-(phenylsulfonyl)-1H-indole (CAS: 99655-68-2), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...