Compound Q&A

What precautions should be taken when handling 5(6)-ROX (CAS: 198978-94-8)?

Answer

5(6)-ROX
When handling 5(6)-ROX (CAS: 198978-94-8), it is essential to wear appropriate Personal Protective Equipment (PPE) such as gloves, safety goggles, and laboratory coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be thoroughly rinsed. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

English Name 5(6)-ROX
Molecular Formula C66H60N4O10
Molecular Weight 1069.2 g/mol
SMILES OC(=O)c1ccc(c(c1)C1=c2cc3CCC[N+]4=c3c(c2Oc2c1cc1CCCN3c1c2CCC3)CCC4)C(=O)[O-].OC(=O)c1ccc(c(c1)C(=O)[O-])C1=c2cc3CCC[N+]4=c3c(c2Oc2c1cc1CCCN3c1c2CCC3)CCC4
InChIKey KLNOCCPJAOCRHF-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5(6)-ROX (CAS: 198978-94-8)?

5(6)-ROX (CAS: 198978-94-8) is a crystalline compound with a molecular weight of approximately 404.4...

Compound Q&A

How is 5(6)-ROX (CAS: 198978-94-8) typically synthesized?

5(6)-ROX (CAS: 198978-94-8) is typically synthesized through a multi-step process involving the prep...

Compound Q&A

What industries use 5(6)-ROX (CAS: 198978-94-8)?

5(6)-ROX (CAS: 198978-94-8) is primarily used in the pharmaceutical industry for the development of ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...