Compound Q&A

What are the physical and chemical properties of 5(6)-ROX (CAS: 198978-94-8)?

Answer

5(6)-ROX
5(6)-ROX (CAS: 198978-94-8) is a crystalline compound with a molecular weight of approximately 404.4 g/mol. It is slightly soluble in water and has good solubility in organic solvents. Chemically, it is stable under normal conditions but can react with strong reducing agents. It is non-flammable and has a low boiling point of around 150°C under reduced pressure.

About

English Name 5(6)-ROX
Molecular Formula C66H60N4O10
Molecular Weight 1069.2 g/mol
SMILES OC(=O)c1ccc(c(c1)C1=c2cc3CCC[N+]4=c3c(c2Oc2c1cc1CCCN3c1c2CCC3)CCC4)C(=O)[O-].OC(=O)c1ccc(c(c1)C(=O)[O-])C1=c2cc3CCC[N+]4=c3c(c2Oc2c1cc1CCCN3c1c2CCC3)CCC4
InChIKey KLNOCCPJAOCRHF-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 5(6)-ROX (CAS: 198978-94-8) typically synthesized?

5(6)-ROX (CAS: 198978-94-8) is typically synthesized through a multi-step process involving the prep...

Compound Q&A

What industries use 5(6)-ROX (CAS: 198978-94-8)?

5(6)-ROX (CAS: 198978-94-8) is primarily used in the pharmaceutical industry for the development of ...

Compound Q&A

What precautions should be taken when handling 5(6)-ROX (CAS: 198978-94-8)?

When handling 5(6)-ROX (CAS: 198978-94-8), it is essential to wear appropriate Personal Protective E...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...