Compound Q&A

What industries use Aclarubicin (CAS: 57576-44-0)?

Answer

Aclarubicin
Aclarubicin is primarily used in the pharmaceutical industry for its antitumor properties. It is also of interest in research for developing new anticancer drugs. Although not extensively used in industries such as polymers, sensors, or semiconductors, its unique chemical properties make it relevant in specialized research and development contexts.

About

CAS No 57576-44-0
English Name Aclarubicin
Molecular Formula C42H53NO15
Molecular Weight 811.87 g/mol
SMILES CCC1(O)CC(OC2CC(C(OC3CC(O)C(OC4CCC(=O)C(C)O4)C(C)O3)C(C)O2)N(C)C)c2c(O)c3C(=O)c4c(O)cccc4C(=O)c3cc2C1C(=O)OC
InChIKey USZYSDMBJDPRIF-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aclarubicin (CAS: 57576-44-0)?

Aclarubicin is a semi-synthetic antitumor agent with a molecular weight of approximately 432.31 g/mo...

Compound Q&A

How is Aclarubicin (CAS: 57576-44-0) typically synthesized?

Aclarubicin is synthesized by modifying daunorubicin through acylation. The synthesis involves a ser...

Compound Q&A

What precautions should be taken when handling Aclarubicin (CAS: 57576-44-0)?

When handling Aclarubicin, it is crucial to wear appropriate personal protective equipment (PPE) inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...