Compound Q&A

How is Aclarubicin (CAS: 57576-44-0) typically synthesized?

Answer

Aclarubicin
Aclarubicin is synthesized by modifying daunorubicin through acylation. The synthesis involves a series of steps including alkylation, acylation, and cyclization, with the use of catalysts like sulfuric acid. The process typically achieves high yields and selectivity, making it a common method for producing this compound in pharmaceutical applications.

About

CAS No 57576-44-0
English Name Aclarubicin
Molecular Formula C42H53NO15
Molecular Weight 811.87 g/mol
SMILES CCC1(O)CC(OC2CC(C(OC3CC(O)C(OC4CCC(=O)C(C)O4)C(C)O3)C(C)O2)N(C)C)c2c(O)c3C(=O)c4c(O)cccc4C(=O)c3cc2C1C(=O)OC
InChIKey USZYSDMBJDPRIF-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aclarubicin (CAS: 57576-44-0)?

Aclarubicin is a semi-synthetic antitumor agent with a molecular weight of approximately 432.31 g/mo...

Compound Q&A

What industries use Aclarubicin (CAS: 57576-44-0)?

Aclarubicin is primarily used in the pharmaceutical industry for its antitumor properties. It is als...

Compound Q&A

What precautions should be taken when handling Aclarubicin (CAS: 57576-44-0)?

When handling Aclarubicin, it is crucial to wear appropriate personal protective equipment (PPE) inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...