Compound Q&A

How is Tris(2,3-dichloropropyl) phosphate (CAS: 78-43-3) typically synthesized?

Answer

Tris(2,3-dichloropropyl) phosphate
Tris(2,3-dichloropropyl) phosphate (CAS: 78-43-3) is synthesized through a multi-step process where chloropropionic acid is first esterified with trialkyl phosphate. This reaction is typically catalyzed by an acid catalyst such as sulfuric acid. The product undergoes further reactions to introduce the dichloro substituents. The overall process requires careful control of reaction conditions to achieve high yield and selectivity.

About

CAS No 78-43-3
English Name Tris(2,3-dichloropropyl) phosphate
Molecular Formula C9H15Cl6O4P
Molecular Weight 430.9 g/mol
SMILES C(C(CCl)Cl)OP(=O)(OCC(CCl)Cl)OCC(CCl)Cl
InChIKey JZZBTMVTLBHJHL-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tris(2,3-dichloropropyl) phosphate (CAS: 78-43-3)?

Tris(2,3-dichloropropyl) phosphate (CAS: 78-43-3) is a colorless to light yellow liquid with a molec...

Compound Q&A

What industries use Tris(2,3-dichloropropyl) phosphate (CAS: 78-43-3)?

Tris(2,3-dichloropropyl) phosphate (CAS: 78-43-3) is widely used in the plastics and polymer industr...

Compound Q&A

What precautions should be taken when handling Tris(2,3-dichloropropyl) phosphate (CAS: 78-43-3)?

When handling Tris(2,3-dichloropropyl) phosphate (CAS: 78-43-3), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...