Compound Q&A

How is 4-(1H-imidazol-1-ylmethyl)benzoic acid (CAS: 94084-75-0) typically synthesized?

Answer

4-(1H-imidazol-1-ylmethyl)benzoic acid
4-(1H-imidazol-1-ylmethyl)benzoic acid is commonly synthesized via a multistep process involving the reaction of benzoic acid with 1H-imidazole. The reaction requires the use of anhydrous conditions and an appropriate solvent. The yield is generally good, and the product can be purified by recrystallization from ethanol or acetone. This synthesis typically involves mild conditions to avoid side reactions.

About

CAS No 94084-75-0
English Name 4-(1H-imidazol-1-ylmethyl)benzoic acid
Molecular Formula C11H10N2O2
Molecular Weight 202.21 g/mol
SMILES C1=CC(=CC=C1CN2C=CN=C2)C(=O)O
InChIKey PBTHRDAMTTXZFL-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(1H-imidazol-1-ylmethyl)benzoic acid (CAS: 94084-75-0)?

4-(1H-imidazol-1-ylmethyl)benzoic acid is a solid with a crystalline form. Its molecular weight is a...

Compound Q&A

What industries use 4-(1H-imidazol-1-ylmethyl)benzoic acid (CAS: 94084-75-0)?

4-(1H-imidazol-1-ylmethyl)benzoic acid is utilized in various industries, particularly in the pharma...

Compound Q&A

What precautions should be taken when handling 4-(1H-imidazol-1-ylmethyl)benzoic acid (CAS: 94084-75-0)?

When handling 4-(1H-imidazol-1-ylmethyl)benzoic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...