Compound Q&A

What are the physical and chemical properties of 4-(1H-imidazol-1-ylmethyl)benzoic acid (CAS: 94084-75-0)?

Answer

4-(1H-imidazol-1-ylmethyl)benzoic acid
4-(1H-imidazol-1-ylmethyl)benzoic acid is a solid with a crystalline form. Its molecular weight is approximately 230.22 g/mol. The compound is poorly soluble in water but more soluble in organic solvents like ethanol and acetone. It is reactive towards basic conditions and can undergo hydrolysis. This compound is often used in organic synthesis and pharmaceutical applications.

About

CAS No 94084-75-0
English Name 4-(1H-imidazol-1-ylmethyl)benzoic acid
Molecular Formula C11H10N2O2
Molecular Weight 202.21 g/mol
SMILES C1=CC(=CC=C1CN2C=CN=C2)C(=O)O
InChIKey PBTHRDAMTTXZFL-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 4-(1H-imidazol-1-ylmethyl)benzoic acid (CAS: 94084-75-0) typically synthesized?

4-(1H-imidazol-1-ylmethyl)benzoic acid is commonly synthesized via a multistep process involving the...

Compound Q&A

What industries use 4-(1H-imidazol-1-ylmethyl)benzoic acid (CAS: 94084-75-0)?

4-(1H-imidazol-1-ylmethyl)benzoic acid is utilized in various industries, particularly in the pharma...

Compound Q&A

What precautions should be taken when handling 4-(1H-imidazol-1-ylmethyl)benzoic acid (CAS: 94084-75-0)?

When handling 4-(1H-imidazol-1-ylmethyl)benzoic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...