Compound Q&A

What precautions should be taken when handling 2,4-difluoro-6-nitroaniline (CAS: 364-30-7)?

Answer

2,4-difluoro-6-nitroaniline
When handling 2,4-difluoro-6-nitroaniline (CAS: 364-30-7), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood. Spills should be immediately neutralized with a suitable base and cleaned up carefully. For detailed safety information, refer to the Material Safety Data Sheet (MSDS/SDS).

About

CAS No 364-30-7
English Name 2,4-difluoro-6-nitroaniline
Molecular Formula C6H4F2N2O2
Molecular Weight 174.1 g/mol
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])N)F)F
InChIKey WPEUQAOOZXFRKZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-difluoro-6-nitroaniline (CAS: 364-30-7)?

2,4-Difluoro-6-nitroaniline (CAS: 364-30-7) is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 2,4-difluoro-6-nitroaniline (CAS: 364-30-7) typically synthesized?

2,4-Difluoro-6-nitroaniline (CAS: 364-30-7) is commonly synthesized via the nitration of 2,4-difluor...

Compound Q&A

What industries use 2,4-difluoro-6-nitroaniline (CAS: 364-30-7)?

2,4-Difluoro-6-nitroaniline (CAS: 364-30-7) is used in various industries, including pharmaceuticals...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...