Compound Q&A

What industries use 2,4-difluoro-6-nitroaniline (CAS: 364-30-7)?

Answer

2,4-difluoro-6-nitroaniline
2,4-Difluoro-6-nitroaniline (CAS: 364-30-7) is used in various industries, including pharmaceuticals for the synthesis of medicinal compounds, and in the production of dyes and pigments. It also finds applications in the preparation of semiconductors and as a precursor in the development of new materials for sensors.

About

CAS No 364-30-7
English Name 2,4-difluoro-6-nitroaniline
Molecular Formula C6H4F2N2O2
Molecular Weight 174.1 g/mol
SMILES C1=C(C=C(C(=C1[N+](=O)[O-])N)F)F
InChIKey WPEUQAOOZXFRKZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-difluoro-6-nitroaniline (CAS: 364-30-7)?

2,4-Difluoro-6-nitroaniline (CAS: 364-30-7) is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 2,4-difluoro-6-nitroaniline (CAS: 364-30-7) typically synthesized?

2,4-Difluoro-6-nitroaniline (CAS: 364-30-7) is commonly synthesized via the nitration of 2,4-difluor...

Compound Q&A

What precautions should be taken when handling 2,4-difluoro-6-nitroaniline (CAS: 364-30-7)?

When handling 2,4-difluoro-6-nitroaniline (CAS: 364-30-7), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...