Compound Q&A

What industries use 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3)?

Answer

6-Chloro-3,4-pyridinedicarboxylic acid
6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3) is primarily used in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients (APIs). It also finds applications in the polymer industry for the production of functional polymers and in the electronics industry for the fabrication of semiconductor materials. Additionally, it has potential uses in the development of sensors and as a precursor in various organic synthesis reactions.

About

English Name 6-Chloro-3,4-pyridinedicarboxylic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=C(C(=CN=C1Cl)C(=O)O)C(=O)O
InChIKey LVQPMCFUDXELIS-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3)?

6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3) is a crystalline solid with a molecular we...

Compound Q&A

How is 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3) typically synthesized?

6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3) can be synthesized via the chlorination of...

Compound Q&A

What precautions should be taken when handling 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3)?

When handling 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3), it is important to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...