Compound Q&A

How is 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3) typically synthesized?

Answer

6-Chloro-3,4-pyridinedicarboxylic acid
6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3) can be synthesized via the chlorination of 3,4-pyridinedicarboxylic acid using thionyl chloride as the chlorinating agent. The reaction typically occurs in a solvent like dichloromethane, and the process is conducted under anhydrous conditions to ensure high yield and selectivity. Additional purification steps, such as recrystallization, may be required to obtain the desired purity.

About

English Name 6-Chloro-3,4-pyridinedicarboxylic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=C(C(=CN=C1Cl)C(=O)O)C(=O)O
InChIKey LVQPMCFUDXELIS-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3)?

6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3) is a crystalline solid with a molecular we...

Compound Q&A

What industries use 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3)?

6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3)?

When handling 6-Chloro-3,4-pyridinedicarboxylic acid (CAS: 243835-70-3), it is important to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...