Compound Q&A

What industries use 2,3,6,7-Tetrachloroquinoxaline (CAS: 25983-14-6)?

Answer

2,3,6,7-Tetrachloroquinoxaline
2,3,6,7-Tetrachloroquinoxaline is used in various industries, including pharmaceuticals for intermediate applications, polymers for specific functionalities, sensors for detecting certain analytes, and semiconductors for specific electronic properties. Its unique chemical structure makes it valuable in these sectors for its reactivity and stability.

About

CAS No 25983-14-6
English Name 2,3,6,7-Tetrachloroquinoxaline
Molecular Formula C8H2Cl4N2
Molecular Weight 267.93 g/mol
SMILES C1=C2C(=CC(=C1Cl)Cl)N=C(C(=N2)Cl)Cl
InChIKey GQWLQHHUPKCOJH-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,6,7-Tetrachloroquinoxaline (CAS: 25983-14-6)?

2,3,6,7-Tetrachloroquinoxaline is a crystalline solid with a molecular weight of approximately 334.0...

Compound Q&A

How is 2,3,6,7-Tetrachloroquinoxaline (CAS: 25983-14-6) typically synthesized?

2,3,6,7-Tetrachloroquinoxaline can be synthesized via chlorination of quinoxaline followed by a seri...

Compound Q&A

What precautions should be taken when handling 2,3,6,7-Tetrachloroquinoxaline (CAS: 25983-14-6)?

When handling 2,3,6,7-Tetrachloroquinoxaline, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...