Compound Q&A

What are the physical and chemical properties of 2,3,6,7-Tetrachloroquinoxaline (CAS: 25983-14-6)?

Answer

2,3,6,7-Tetrachloroquinoxaline
2,3,6,7-Tetrachloroquinoxaline is a crystalline solid with a molecular weight of approximately 334.01 g/mol. It has a low water solubility and is highly reactive towards nucleophiles. This compound is stable under normal conditions but should be stored away from moisture and heat. It has a characteristic odor and is known for its thermal stability.

About

CAS No 25983-14-6
English Name 2,3,6,7-Tetrachloroquinoxaline
Molecular Formula C8H2Cl4N2
Molecular Weight 267.93 g/mol
SMILES C1=C2C(=CC(=C1Cl)Cl)N=C(C(=N2)Cl)Cl
InChIKey GQWLQHHUPKCOJH-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 2,3,6,7-Tetrachloroquinoxaline (CAS: 25983-14-6) typically synthesized?

2,3,6,7-Tetrachloroquinoxaline can be synthesized via chlorination of quinoxaline followed by a seri...

Compound Q&A

What industries use 2,3,6,7-Tetrachloroquinoxaline (CAS: 25983-14-6)?

2,3,6,7-Tetrachloroquinoxaline is used in various industries, including pharmaceuticals for intermed...

Compound Q&A

What precautions should be taken when handling 2,3,6,7-Tetrachloroquinoxaline (CAS: 25983-14-6)?

When handling 2,3,6,7-Tetrachloroquinoxaline, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...