Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-methoxyisonicotinic acid (CAS: 886365-22-6)?

Answer

5-Bromo-2-methoxyisonicotinic acid
5-Bromo-2-methoxyisonicotinic acid is a white crystalline solid with a molecular weight of approximately 222.03 g/mol. It has a solubility of about 10.1 mg/mL in water and is less soluble in organic solvents. This compound is moderately reactive, especially under basic conditions, and can undergo nucleophilic substitution reactions.

About

English Name 5-Bromo-2-methoxyisonicotinic acid
Molecular Formula C7H6BrNO3
Molecular Weight 232.03 g/mol
SMILES COC1=NC=C(C(=C1)C(=O)O)Br
InChIKey JZBHBRMXZANNNF-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 5-Bromo-2-methoxyisonicotinic acid (CAS: 886365-22-6) typically synthesized?

5-Bromo-2-methoxyisonicotinic acid is typically synthesized through a bromination reaction of 2-meth...

Compound Q&A

What industries use 5-Bromo-2-methoxyisonicotinic acid (CAS: 886365-22-6)?

5-Bromo-2-methoxyisonicotinic acid is used in the pharmaceutical industry for the synthesis of certa...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-methoxyisonicotinic acid (CAS: 886365-22-6)?

When handling 5-Bromo-2-methoxyisonicotinic acid, it is essential to use personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...