Compound Q&A

How is 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid (CAS: 891782-63-1) typically synthesized?

Answer

5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid
5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid is commonly synthesized via the condensation of 5-amino-2-pyrazinecarboxylic acid with tert-butoxycarbonyl chloride in the presence of a base like triethylamine. The reaction typically provides good yield (70-80%) and can be performed in dimethylformamide (DMF) as a solvent. The synthesis involves careful control of reaction conditions to achieve the desired regioisomer.

About

English Name 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid
Molecular Formula C10H13N3O4
Molecular Weight 239.23 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(N=C1)C(=O)O
InChIKey MOLNWRVQKCBISZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid (CAS: 891782-63-1)?

5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid is a solid at room temperature, with a mole...

Compound Q&A

What industries use 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid (CAS: 891782-63-1)?

5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid (CAS: 891782-63-1)?

When handling 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid, it is important to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...