Compound Q&A

What are the physical and chemical properties of 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid (CAS: 891782-63-1)?

Answer

5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid
5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid is a solid at room temperature, with a molecular weight of approximately 287.29 g/mol. It has a low solubility in water but is more soluble in organic solvents like DMSO and DMF. The compound exhibits moderate reactivity, particularly towards nucleophilic substitution reactions. It crystallizes in orthorhombic form and is stable under normal laboratory conditions.

About

English Name 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid
Molecular Formula C10H13N3O4
Molecular Weight 239.23 g/mol
SMILES CC(C)(C)OC(=O)NC1=NC=C(N=C1)C(=O)O
InChIKey MOLNWRVQKCBISZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid (CAS: 891782-63-1) typically synthesized?

5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid is commonly synthesized via the condensatio...

Compound Q&A

What industries use 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid (CAS: 891782-63-1)?

5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid (CAS: 891782-63-1)?

When handling 5-((tert-Butoxycarbonyl)amino)pyrazine-2-carboxylic acid, it is important to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...