Compound Q&A

What precautions should be taken when handling Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3)?

Answer

Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate
When handling Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using absorbent materials, and proper disposal methods should be followed. Always consult the Safety Data Sheet (SDS) for specific handling and emergency procedures.

About

English Name Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate
Molecular Formula C9H22BF4P
Molecular Weight 248.05 g/mol
SMILES [B-](F)(F)(F)F.CC(C)(C)[PH+](C)C(C)(C)C
InChIKey BRDLRXCAHKUWJS-UHFFFAOYSA-O
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3)?

Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3) is a crystalline co...

Compound Q&A

How is Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3) typically synthesized?

Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3) is typically synthe...

Compound Q&A

What industries use Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3)?

Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3) is used in the phar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...