Compound Q&A

What are the physical and chemical properties of Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3)?

Answer

Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate
Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3) is a crystalline compound with a molecular weight of approximately 320.2 g/mol. It is slightly soluble in water and organic solvents. This compound is highly reactive, especially in acidic conditions, and it can act as a Lewis acid due to the presence of the tetrafluoroborate anion.

About

English Name Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate
Molecular Formula C9H22BF4P
Molecular Weight 248.05 g/mol
SMILES [B-](F)(F)(F)F.CC(C)(C)[PH+](C)C(C)(C)C
InChIKey BRDLRXCAHKUWJS-UHFFFAOYSA-O
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3) typically synthesized?

Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3) is typically synthe...

Compound Q&A

What industries use Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3)?

Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3) is used in the phar...

Compound Q&A

What precautions should be taken when handling Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3)?

When handling Methyl[bis(2-methyl-2-propanyl)]phosphonium tetrafluoroborate (CAS: 870777-30-3), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...