Compound Q&A

How is L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) (CAS: 160369-83-5) typically synthesized?

Answer

L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1)
L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) is typically synthesized by the reaction of L-Lysine with trifluoroacetic anhydride and dimethyl carbonate in the presence of a catalyst. This process involves the formation of a trifluoroacetate ester, followed by the introduction of carboxymethyl groups. The synthesis yields a high purity product with good selectivity and yield, making it suitable for various applications in pharmaceutical and biochemical industries.

About

English Name L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1)
Molecular Formula C10H18N2O6
Molecular Weight 262.26 g/mol
SMILES C(CCN)CC(C(=O)O)N(CC(=O)O)CC(=O)O
InChIKey SYFQYGMJENQVQT-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) (CAS: 160369-83-5)?

L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) is a white crystalline powder. It ...

Compound Q&A

What industries use L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) (CAS: 160369-83-5)?

L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) finds extensive use in the pharmac...

Compound Q&A

What precautions should be taken when handling L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) (CAS: 160369-83-5)?

When handling L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...