Compound Q&A

What are the physical and chemical properties of L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) (CAS: 160369-83-5)?

Answer

L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1)
L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) is a white crystalline powder. It has a molecular weight of approximately 460.33 g/mol and is highly soluble in water. This compound is known for its reactivity with nucleophiles and its ability to form stable complexes with metal ions. It exhibits good solubility in organic solvents such as methanol and ethanol. It is often used in pharmaceutical and biochemical applications due to its reactivity and stability.

About

English Name L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1)
Molecular Formula C10H18N2O6
Molecular Weight 262.26 g/mol
SMILES C(CCN)CC(C(=O)O)N(CC(=O)O)CC(=O)O
InChIKey SYFQYGMJENQVQT-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) (CAS: 160369-83-5) typically synthesized?

L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) is typically synthesized by the re...

Compound Q&A

What industries use L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) (CAS: 160369-83-5)?

L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) finds extensive use in the pharmac...

Compound Q&A

What precautions should be taken when handling L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1) (CAS: 160369-83-5)?

When handling L-Lysine, N2,N2-bis(carboxymethyl)-, 2,2,2-trifluoroacetate (1:1), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...