Compound Q&A

What precautions should be taken when handling 5-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 7312-10-9)?

Answer

5-Bromo-1-benzothiophene-2-carboxylic acid
When handling 5-Bromo-1-benzothiophene-2-carboxylic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. The compound should be used in a well-ventilated area or a fume hood to minimize exposure to bromine fumes. In case of a spill, it is important to follow the material safety data sheet (MSDS) guidelines for proper disposal and clean-up. Always consult the SDS for detailed safety information.

About

CAS No 7312-10-9
English Name 5-Bromo-1-benzothiophene-2-carboxylic acid
Molecular Formula C9H5BrO2S
Molecular Weight 257.11 g/mol
SMILES C1=CC2=C(C=C1Br)C=C(S2)C(=O)O
InChIKey ONNFNEFYXIPHCA-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 7312-10-9)?

5-Bromo-1-benzothiophene-2-carboxylic acid is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 5-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 7312-10-9) typically synthesized?

5-Bromo-1-benzothiophene-2-carboxylic acid is typically synthesized via bromination of 1-benzothioph...

Compound Q&A

What industries use 5-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 7312-10-9)?

5-Bromo-1-benzothiophene-2-carboxylic acid is used in various industries. It is a key intermediate i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...