Compound Q&A

What industries use 5-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 7312-10-9)?

Answer

5-Bromo-1-benzothiophene-2-carboxylic acid
5-Bromo-1-benzothiophene-2-carboxylic acid is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in the development of antitumor drugs. It is also utilized in the production of organic electronic materials, such as semiconductors and organic light-emitting diodes (OLEDs). Additionally, it has applications in the preparation of polymer-based sensors.

About

CAS No 7312-10-9
English Name 5-Bromo-1-benzothiophene-2-carboxylic acid
Molecular Formula C9H5BrO2S
Molecular Weight 257.11 g/mol
SMILES C1=CC2=C(C=C1Br)C=C(S2)C(=O)O
InChIKey ONNFNEFYXIPHCA-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 7312-10-9)?

5-Bromo-1-benzothiophene-2-carboxylic acid is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 5-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 7312-10-9) typically synthesized?

5-Bromo-1-benzothiophene-2-carboxylic acid is typically synthesized via bromination of 1-benzothioph...

Compound Q&A

What precautions should be taken when handling 5-Bromo-1-benzothiophene-2-carboxylic acid (CAS: 7312-10-9)?

When handling 5-Bromo-1-benzothiophene-2-carboxylic acid, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...