Compound Q&A

How is Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9) typically synthesized?

Answer

Tri-p-tolylsulfonium Hexafluorophosphate
Tri-p-tolylsulfonium Hexafluorophosphate can be synthesized by reacting p-tolylsulfonium hexafluorophosphate with 1,3,5-tritolylmethylmethanesulfonate. The reaction involves a Friedel-Crafts type mechanism and typically yields a high purity product with good selectivity. The synthesis usually requires anhydrous conditions and the use of a phase transfer catalyst like tetrabutylammonium fluoride.

About

English Name Tri-p-tolylsulfonium Hexafluorophosphate
Molecular Formula C21H21F6PS
Molecular Weight 450.42 g/mol
SMILES CC1=CC=C(C=C1)[S+](C2=CC=C(C=C2)C)C3=CC=C(C=C3)C.F[P-](F)(F)(F)(F)F
InChIKey BIWXKHOYLGAZDG-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9)?

Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9) is a crystalline solid with a molecular ...

Compound Q&A

What industries use Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9)?

Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9) finds applications in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9)?

When handling Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...