Compound Q&A

What are the physical and chemical properties of Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9)?

Answer

Tri-p-tolylsulfonium Hexafluorophosphate
Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9) is a crystalline solid with a molecular weight of approximately 607.6 g/mol. It is poorly soluble in water but readily soluble in organic solvents like acetonitrile and dimethylformamide. The compound is highly reactive, especially in polar solvents, and can undergo various types of nucleophilic substitution reactions.

About

English Name Tri-p-tolylsulfonium Hexafluorophosphate
Molecular Formula C21H21F6PS
Molecular Weight 450.42 g/mol
SMILES CC1=CC=C(C=C1)[S+](C2=CC=C(C=C2)C)C3=CC=C(C=C3)C.F[P-](F)(F)(F)(F)F
InChIKey BIWXKHOYLGAZDG-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9) typically synthesized?

Tri-p-tolylsulfonium Hexafluorophosphate can be synthesized by reacting p-tolylsulfonium hexafluorop...

Compound Q&A

What industries use Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9)?

Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9) finds applications in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9)?

When handling Tri-p-tolylsulfonium Hexafluorophosphate (CAS: 146062-15-9), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...