Compound Q&A

What industries use 4-Fluoro-1,3-benzothiazole-2-carboxylic acid (CAS: 479028-70-1)?

Answer

4-Fluoro-1,3-benzothiazole-2-carboxylic acid
4-Fluoro-1,3-benzothiazole-2-carboxylic acid finds applications in various industries. It is used in pharmaceuticals for the synthesis of drug intermediates, in polymers for enhancing material properties, and in chemical sensors for detecting specific analytes. Additionally, it is utilized in the preparation of semiconductors due to its unique physical and chemical properties.

About

English Name 4-Fluoro-1,3-benzothiazole-2-carboxylic acid
Molecular Formula C8H4FNO2S
Molecular Weight 197.19 g/mol
SMILES C1=CC(=C2C(=C1)SC(=N2)C(=O)O)F
InChIKey KFFJBGWTRIOOEN-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Fluoro-1,3-benzothiazole-2-carboxylic acid (CAS: 479028-70-1)?

4-Fluoro-1,3-benzothiazole-2-carboxylic acid is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 4-Fluoro-1,3-benzothiazole-2-carboxylic acid (CAS: 479028-70-1) typically synthesized?

4-Fluoro-1,3-benzothiazole-2-carboxylic acid is usually synthesized via the acylation of 4-fluoroben...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-1,3-benzothiazole-2-carboxylic acid (CAS: 479028-70-1)?

When handling 4-Fluoro-1,3-benzothiazole-2-carboxylic acid, appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...