Compound Q&A

How is 4-Fluoro-1,3-benzothiazole-2-carboxylic acid (CAS: 479028-70-1) typically synthesized?

Answer

4-Fluoro-1,3-benzothiazole-2-carboxylic acid
4-Fluoro-1,3-benzothiazole-2-carboxylic acid is usually synthesized via the acylation of 4-fluorobenzothiazole with a carboxylic acid chloride or anhydride. Common catalysts include triethylamine or pyridine, and the reaction typically yields 80-90% purity. The product is isolated by recrystallization from a suitable solvent.

About

English Name 4-Fluoro-1,3-benzothiazole-2-carboxylic acid
Molecular Formula C8H4FNO2S
Molecular Weight 197.19 g/mol
SMILES C1=CC(=C2C(=C1)SC(=N2)C(=O)O)F
InChIKey KFFJBGWTRIOOEN-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Fluoro-1,3-benzothiazole-2-carboxylic acid (CAS: 479028-70-1)?

4-Fluoro-1,3-benzothiazole-2-carboxylic acid is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 4-Fluoro-1,3-benzothiazole-2-carboxylic acid (CAS: 479028-70-1)?

4-Fluoro-1,3-benzothiazole-2-carboxylic acid finds applications in various industries. It is used in...

Compound Q&A

What precautions should be taken when handling 4-Fluoro-1,3-benzothiazole-2-carboxylic acid (CAS: 479028-70-1)?

When handling 4-Fluoro-1,3-benzothiazole-2-carboxylic acid, appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...