Compound Q&A

What industries use Methyl 4-(1-bromoethyl)benzoate (CAS: 16281-97-3)?

Answer

Methyl 4-(1-bromoethyl)benzoate
Methyl 4-(1-bromoethyl)benzoate (CAS: 16281-97-3) is used in the pharmaceutical industry for the synthesis of various compounds, and in the polymer industry for specific applications requiring brominated functionalities. It is also relevant in the production of sensors and semiconductors due to its brominated structure.

About

CAS No 16281-97-3
English Name Methyl 4-(1-bromoethyl)benzoate
Molecular Formula C10H11BrO2
Molecular Weight 243.1 g/mol
SMILES CC(C1=CC=C(C=C1)C(=O)OC)Br
InChIKey IXZOUWPYWNKWCX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(1-bromoethyl)benzoate (CAS: 16281-97-3)?

Methyl 4-(1-bromoethyl)benzoate (CAS: 16281-97-3) is a white crystalline solid with a molecular weig...

Compound Q&A

How is Methyl 4-(1-bromoethyl)benzoate (CAS: 16281-97-3) typically synthesized?

Methyl 4-(1-bromoethyl)benzoate is commonly synthesized via the reaction of 4-(1-hydroxyethyl)benzoi...

Compound Q&A

What precautions should be taken when handling Methyl 4-(1-bromoethyl)benzoate (CAS: 16281-97-3)?

Proper Personal Protective Equipment (PPE), including gloves and safety goggles, is essential when h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...