Compound Q&A

What industries use 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS: 837-95-6)?

Answer

2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride
2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride is used in the pharmaceutical industry for the synthesis of certain intermediates and APIs. It is also utilized in the polymer industry for the preparation of advanced materials. Additionally, it has applications in sensor technologies and semiconductor manufacturing due to its unique chemical properties.

About

CAS No 837-95-6
English Name 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C7H3ClF3NO4S
Molecular Weight 289.62 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])S(=O)(=O)Cl
InChIKey KXEMVGQZZLRLBE-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS: 837-95-6)?

2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride is a white crystalline solid with a molecular we...

Compound Q&A

How is 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS: 837-95-6) typically synthesized?

2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride can be synthesized by first sulfonating 4-(trifl...

Compound Q&A

What precautions should be taken when handling 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS: 837-95-6)?

When handling 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride, it is crucial to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...