Compound Q&A

How is 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS: 837-95-6) typically synthesized?

Answer

2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride
2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride can be synthesized by first sulfonating 4-(trifluoromethyl)benzenesulfonic acid with thionyl chloride, followed by nitration using a mixture of nitric acid and sulfuric acid. This process requires careful control of reaction conditions to achieve high yield and selectivity.

About

CAS No 837-95-6
English Name 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C7H3ClF3NO4S
Molecular Weight 289.62 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])S(=O)(=O)Cl
InChIKey KXEMVGQZZLRLBE-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS: 837-95-6)?

2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride is a white crystalline solid with a molecular we...

Compound Q&A

What industries use 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS: 837-95-6)?

2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS: 837-95-6)?

When handling 2-Nitro-4-(trifluoromethyl)benzenesulfonyl chloride, it is crucial to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...