Compound Q&A

What industries use 4,5,9,10-Tetrahydropyrene (CAS: 781-17-9)?

Answer

4,5,9,10-Tetrahydropyrene
4,5,9,10-Tetrahydropyrene is used in various industries. It is an important intermediate in the synthesis of other chemical compounds, particularly in the pharmaceutical and polymer industries. It also finds applications in the production of sensors and semiconductors due to its unique electronic properties.

About

CAS No 781-17-9
English Name 4,5,9,10-Tetrahydropyrene
Molecular Formula C16H14
Molecular Weight 206.28799999999995 g/mol
SMILES C1CC2=C3C(=CC=C2)CCC4=CC=CC1=C43
InChIKey XDFUNRTWHPWCKO-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5,9,10-Tetrahydropyrene (CAS: 781-17-9)?

4,5,9,10-Tetrahydropyrene is a solid, crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is 4,5,9,10-Tetrahydropyrene (CAS: 781-17-9) typically synthesized?

4,5,9,10-Tetrahydropyrene is commonly synthesized via the hydrogenation of pyrene under the presence...

Compound Q&A

What precautions should be taken when handling 4,5,9,10-Tetrahydropyrene (CAS: 781-17-9)?

When handling 4,5,9,10-Tetrahydropyrene, it is essential to use appropriate personal protective equi...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A