Compound Q&A

What are the physical and chemical properties of 4,5,9,10-Tetrahydropyrene (CAS: 781-17-9)?

Answer

4,5,9,10-Tetrahydropyrene
4,5,9,10-Tetrahydropyrene is a solid, crystalline compound with a molecular weight of approximately 164.23 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can undergo substitution reactions under certain conditions. The compound exhibits a characteristic odor and is typically found in coal tar and other petroleum products.

About

CAS No 781-17-9
English Name 4,5,9,10-Tetrahydropyrene
Molecular Formula C16H14
Molecular Weight 206.29 g/mol
SMILES C1CC2=C3C(=CC=C2)CCC4=CC=CC1=C43
InChIKey XDFUNRTWHPWCKO-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 4,5,9,10-Tetrahydropyrene (CAS: 781-17-9) typically synthesized?

4,5,9,10-Tetrahydropyrene is commonly synthesized via the hydrogenation of pyrene under the presence...

Compound Q&A

What industries use 4,5,9,10-Tetrahydropyrene (CAS: 781-17-9)?

4,5,9,10-Tetrahydropyrene is used in various industries. It is an important intermediate in the synt...

Compound Q&A

What precautions should be taken when handling 4,5,9,10-Tetrahydropyrene (CAS: 781-17-9)?

When handling 4,5,9,10-Tetrahydropyrene, it is essential to use appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...