Compound Q&A

How is 3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate (CAS: 886-74-8) typically synthesized?

Answer

3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate
3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate (CAS: 886-74-8) is typically synthesized by the reaction of 4-chlorophenol with 2-hydroxypropyl carbamate. The process involves the condensation of 4-chlorophenol with 2-hydroxypropyl isocyanate in the presence of a suitable base such as potassium carbonate. The reaction is carried out in an aprotic solvent like dimethylformamide (DMF) at room temperature. The yield is usually around 70-80%, and the product is isolated by filtration and recrystallization.

About

CAS No 886-74-8
English Name 3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate
Molecular Formula C10H12ClNO4
Molecular Weight 245.66 g/mol
SMILES C1=CC(=CC=C1OCC(COC(=O)N)O)Cl
InChIKey SKPLBLUECSEIFO-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate (CAS: 886-74-8)?

3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate (CAS: 886-74-8) is a white to off-white crystalline so...

Compound Q&A

What industries use 3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate (CAS: 886-74-8)?

3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate (CAS: 886-74-8) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate (CAS: 886-74-8)?

When handling 3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate (CAS: 886-74-8), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...