Compound Q&A

What precautions should be taken when handling Rg-1530 (CAS: 882531-87-5)?

Answer

Rg-1530
When handling Rg-1530, it is essential to use personal protective equipment (PPE) such as gloves and goggles. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up according to the Material Safety Data Sheet (MSDS) guidelines, and the compound should be stored in a cool, dry place away from direct sunlight and flammable materials. Always refer to the SDS for detailed safety information.

About

English Name Rg-1530
Molecular Formula C18H14ClFN4O
Molecular Weight 356.79 g/mol
SMILES CC1=C2C(=NN1)NC3=CC(=C(C=C3C(=N2)C4=CC=CC=C4Cl)F)OC
InChIKey UOVCGJXDGOGOCZ-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rg-1530 (CAS: 882531-87-5)?

Rg-1530 is a crystalline compound with a molecular weight of approximately 1530. It has a high solub...

Compound Q&A

How is Rg-1530 (CAS: 882531-87-5) typically synthesized?

Rg-1530 is typically synthesized through a multi-step process involving reactions with diethyl carbo...

Compound Q&A

What industries use Rg-1530 (CAS: 882531-87-5)?

Rg-1530 is primarily used in the pharmaceutical industry for the development of new drugs. It is als...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...