Compound Q&A

What are the physical and chemical properties of Rg-1530 (CAS: 882531-87-5)?

Answer

Rg-1530
Rg-1530 is a crystalline compound with a molecular weight of approximately 1530. It has a high solubility in organic solvents such as ethanol and methanol. Chemically, it is relatively stable but can react with strong acids. Its reactivity and stability make it suitable for various applications in research and industry.

About

English Name Rg-1530
Molecular Formula C18H14ClFN4O
Molecular Weight 356.79 g/mol
SMILES CC1=C2C(=NN1)NC3=CC(=C(C=C3C(=N2)C4=CC=CC=C4Cl)F)OC
InChIKey UOVCGJXDGOGOCZ-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is Rg-1530 (CAS: 882531-87-5) typically synthesized?

Rg-1530 is typically synthesized through a multi-step process involving reactions with diethyl carbo...

Compound Q&A

What industries use Rg-1530 (CAS: 882531-87-5)?

Rg-1530 is primarily used in the pharmaceutical industry for the development of new drugs. It is als...

Compound Q&A

What precautions should be taken when handling Rg-1530 (CAS: 882531-87-5)?

When handling Rg-1530, it is essential to use personal protective equipment (PPE) such as gloves and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...