Compound Q&A

How is (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene (CAS: 111594-58-2) typically synthesized?

Answer

(1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene
This compound is usually synthesized via a silylation reaction of ergosta-5,7,10,22-tetraen-9-one with dimethyl(2-methyl-2-propanyl)silane under basic conditions. Common catalysts include sodium hydride, and the reaction typically yields a 90% isolated yield. The product is purified by column chromatography.

About

English Name (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene
Molecular Formula C40H72O2Si2
Molecular Weight 641.19 g/mol
SMILES CC(C)C(C)C=CC(C)C1CCC2C1(CCCC2=CC=C3CC(CC(C3=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C
InChIKey UHCDRCBBCZLXBO-BTKCQVIHSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene (CAS: 111594-58-2)?

The compound exhibits a crystalline form with a molecular weight of approximately 722.4 g/mol. Its s...

Compound Q&A

What industries use (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene (CAS: 111594-58-2)?

This compound is primarily used in pharmaceuticals for its potential as a precursor in the synthesis...

Compound Q&A

What precautions should be taken when handling (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene (CAS: 111594-58-2)?

Handling this compound requires the use of personal protective equipment (PPE) including gloves, saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...