Compound Q&A

What are the physical and chemical properties of (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene (CAS: 111594-58-2)?

Answer

(1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene
The compound exhibits a crystalline form with a molecular weight of approximately 722.4 g/mol. Its solubility in common organic solvents is moderate. Chemically, it shows moderate reactivity towards hydrogenation and can undergo typical silylation reactions. It is not highly reactive but requires careful handling due to its silyl functional groups.

About

English Name (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene
Molecular Formula C40H72O2Si2
Molecular Weight 641.19 g/mol
SMILES CC(C)C(C)C=CC(C)C1CCC2C1(CCCC2=CC=C3CC(CC(C3=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C
InChIKey UHCDRCBBCZLXBO-BTKCQVIHSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene (CAS: 111594-58-2) typically synthesized?

This compound is usually synthesized via a silylation reaction of ergosta-5,7,10,22-tetraen-9-one wi...

Compound Q&A

What industries use (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene (CAS: 111594-58-2)?

This compound is primarily used in pharmaceuticals for its potential as a precursor in the synthesis...

Compound Q&A

What precautions should be taken when handling (1S,3R,5E,7E,22E)-1,3-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-9,10-secoergosta-5,7,10,22-tetraene (CAS: 111594-58-2)?

Handling this compound requires the use of personal protective equipment (PPE) including gloves, saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...