Compound Q&A

What industries use 4-Biphenylyl benzoate (CAS: 2170-13-0)?

Answer

4-Biphenylyl benzoate
4-Biphenylyl benzoate (CAS: 2170-13-0) is used in various industries. It is employed as a raw material in the pharmaceutical industry for certain drug formulations. In the polymer industry, it serves as a plasticizer. Additionally, it is utilized in the production of sensors and semiconductors due to its unique chemical properties. Its applications span across research and development in material science and electronics.

About

CAS No 2170-13-0
English Name 4-Biphenylyl benzoate
Molecular Formula C19H14O2
Molecular Weight 274.32 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C3=CC=CC=C3
InChIKey CINHWMYRCOGYIX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Biphenylyl benzoate (CAS: 2170-13-0)?

4-Biphenylyl benzoate (CAS: 2170-13-0) is a crystalline compound with a molecular formula of C21H16O...

Compound Q&A

How is 4-Biphenylyl benzoate (CAS: 2170-13-0) typically synthesized?

4-Biphenylyl benzoate (CAS: 2170-13-0) can be synthesized by the esterification of benzoic acid with...

Compound Q&A

What precautions should be taken when handling 4-Biphenylyl benzoate (CAS: 2170-13-0)?

When handling 4-Biphenylyl benzoate (CAS: 2170-13-0), it is important to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...