Compound Q&A

What are the physical and chemical properties of 4-Biphenylyl benzoate (CAS: 2170-13-0)?

Answer

4-Biphenylyl benzoate
4-Biphenylyl benzoate (CAS: 2170-13-0) is a crystalline compound with a molecular formula of C21H16O2. It has a molecular weight of approximately 300.37 g/mol. The compound is slightly soluble in water but soluble in organic solvents like ethanol and acetone. It is relatively stable under normal conditions but can undergo hydrolysis in the presence of strong acids or bases. The compound is known for its low reactivity under typical laboratory conditions.

About

CAS No 2170-13-0
English Name 4-Biphenylyl benzoate
Molecular Formula C19H14O2
Molecular Weight 274.32 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C3=CC=CC=C3
InChIKey CINHWMYRCOGYIX-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 4-Biphenylyl benzoate (CAS: 2170-13-0) typically synthesized?

4-Biphenylyl benzoate (CAS: 2170-13-0) can be synthesized by the esterification of benzoic acid with...

Compound Q&A

What industries use 4-Biphenylyl benzoate (CAS: 2170-13-0)?

4-Biphenylyl benzoate (CAS: 2170-13-0) is used in various industries. It is employed as a raw materi...

Compound Q&A

What precautions should be taken when handling 4-Biphenylyl benzoate (CAS: 2170-13-0)?

When handling 4-Biphenylyl benzoate (CAS: 2170-13-0), it is important to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...