Compound Q&A

What are the physical and chemical properties of 1-Chloro-3,5-bis(trifluoromethyl)benzene (CAS: 328-72-3)?

Answer

1-Chloro-3,5-bis(trifluoromethyl)benzene
1-Chloro-3,5-bis(trifluoromethyl)benzene (CAS: 328-72-3) is a colorless or light yellow solid with a molecular weight of 299.62 g/mol. It has a low solubility in water but is freely soluble in organic solvents like dichloromethane and acetonitrile. The compound is known for its high reactivity towards nucleophiles and electrophiles. It is a potent electrophile due to the presence of the trifluoromethyl groups, which activate the benzene ring for substitution reactions.

About

CAS No 328-72-3
English Name 1-Chloro-3,5-bis(trifluoromethyl)benzene
Molecular Formula C8H3ClF6
Molecular Weight 248.55 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)Cl)C(F)(F)F
InChIKey OXMBWPJFVUPOFO-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 1-Chloro-3,5-bis(trifluoromethyl)benzene (CAS: 328-72-3) typically synthesized?

1-Chloro-3,5-bis(trifluoromethyl)benzene (CAS: 328-72-3) can be synthesized via the Friedel-Crafts a...

Compound Q&A

What industries use 1-Chloro-3,5-bis(trifluoromethyl)benzene (CAS: 328-72-3)?

1-Chloro-3,5-bis(trifluoromethyl)benzene (CAS: 328-72-3) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling 1-Chloro-3,5-bis(trifluoromethyl)benzene (CAS: 328-72-3)?

When handling 1-Chloro-3,5-bis(trifluoromethyl)benzene (CAS: 328-72-3), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...