Compound Q&A

How is Phenyl(1-piperidinyl)methanone (CAS: 776-75-0) typically synthesized?

Answer

Phenyl(1-piperidinyl)methanone
Phenyl(1-piperidinyl)methanone can be synthesized via the reaction of piperidine with phenyl ketones in the presence of an acid catalyst such as hydrochloric acid. The method involves the condensation of piperidine with the phenyl ketone, followed by the dehydration of the resulting secondary alcohol under acidic conditions. The yield and selectivity can be improved by optimizing reaction conditions such as temperature, concentration, and presence of catalysts.

About

CAS No 776-75-0
English Name Phenyl(1-piperidinyl)methanone
Molecular Formula C12H15NO
Molecular Weight 189.26 g/mol
SMILES C1CCN(CC1)C(=O)C2=CC=CC=C2
InChIKey YXTROGRGRSPWKL-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phenyl(1-piperidinyl)methanone (CAS: 776-75-0)?

Phenyl(1-piperidinyl)methanone (CAS: 776-75-0) is a white crystalline solid with a molecular weight ...

Compound Q&A

What industries use Phenyl(1-piperidinyl)methanone (CAS: 776-75-0)?

Phenyl(1-piperidinyl)methanone (CAS: 776-75-0) is primarily used in the pharmaceutical industry as a...

Compound Q&A

What precautions should be taken when handling Phenyl(1-piperidinyl)methanone (CAS: 776-75-0)?

When handling Phenyl(1-piperidinyl)methanone (CAS: 776-75-0), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...