Compound Q&A

What are the physical and chemical properties of Phenyl(1-piperidinyl)methanone (CAS: 776-75-0)?

Answer

Phenyl(1-piperidinyl)methanone
Phenyl(1-piperidinyl)methanone (CAS: 776-75-0) is a white crystalline solid with a molecular weight of approximately 229.3 g/mol. It has a melting point of 100-102°C and is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. It is highly reactive towards nucleophiles and can undergo various transformations under appropriate conditions, making it a versatile compound in organic synthesis.

About

CAS No 776-75-0
English Name Phenyl(1-piperidinyl)methanone
Molecular Formula C12H15NO
Molecular Weight 189.26 g/mol
SMILES C1CCN(CC1)C(=O)C2=CC=CC=C2
InChIKey YXTROGRGRSPWKL-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is Phenyl(1-piperidinyl)methanone (CAS: 776-75-0) typically synthesized?

Phenyl(1-piperidinyl)methanone can be synthesized via the reaction of piperidine with phenyl ketones...

Compound Q&A

What industries use Phenyl(1-piperidinyl)methanone (CAS: 776-75-0)?

Phenyl(1-piperidinyl)methanone (CAS: 776-75-0) is primarily used in the pharmaceutical industry as a...

Compound Q&A

What precautions should be taken when handling Phenyl(1-piperidinyl)methanone (CAS: 776-75-0)?

When handling Phenyl(1-piperidinyl)methanone (CAS: 776-75-0), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...