Compound Q&A

How is 2,1,3-Benzothiadiazole-4-sulfonyl chloride (CAS: 73713-79-8) typically synthesized?

Answer

2,1,3-Benzothiadiazole-4-sulfonyl chloride
2,1,3-Benzothiadiazole-4-sulfonyl chloride is synthesized by the reaction of 2,1,3-benzothiadiazole with thionyl chloride. This reaction typically requires heating and proceeds with good yield and selectivity. The use of anhydrous conditions ensures the stability and efficacy of the reaction.

About

CAS No 73713-79-8
English Name 2,1,3-Benzothiadiazole-4-sulfonyl chloride
Molecular Formula C6H3ClN2O2S2
Molecular Weight 234.69 g/mol
SMILES C1=CC2=NSN=C2C(=C1)S(=O)(=O)Cl
InChIKey CXAICGCTHOWKPP-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,1,3-Benzothiadiazole-4-sulfonyl chloride (CAS: 73713-79-8)?

2,1,3-Benzothiadiazole-4-sulfonyl chloride is a crystalline compound with a molecular weight of appr...

Compound Q&A

What industries use 2,1,3-Benzothiadiazole-4-sulfonyl chloride (CAS: 73713-79-8)?

2,1,3-Benzothiadiazole-4-sulfonyl chloride finds applications in pharmaceuticals for its potential a...

Compound Q&A

What precautions should be taken when handling 2,1,3-Benzothiadiazole-4-sulfonyl chloride (CAS: 73713-79-8)?

Proper handling of 2,1,3-Benzothiadiazole-4-sulfonyl chloride requires the use of personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...