Compound Q&A

What are the physical and chemical properties of 2,1,3-Benzothiadiazole-4-sulfonyl chloride (CAS: 73713-79-8)?

Answer

2,1,3-Benzothiadiazole-4-sulfonyl chloride
2,1,3-Benzothiadiazole-4-sulfonyl chloride is a crystalline compound with a molecular weight of approximately 223.21 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is known for its reactivity, particularly in nucleophilic substitution reactions. It is a strong electrophile due to the presence of the sulfonyl chloride group.

About

CAS No 73713-79-8
English Name 2,1,3-Benzothiadiazole-4-sulfonyl chloride
Molecular Formula C6H3ClN2O2S2
Molecular Weight 234.69 g/mol
SMILES C1=CC2=NSN=C2C(=C1)S(=O)(=O)Cl
InChIKey CXAICGCTHOWKPP-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

How is 2,1,3-Benzothiadiazole-4-sulfonyl chloride (CAS: 73713-79-8) typically synthesized?

2,1,3-Benzothiadiazole-4-sulfonyl chloride is synthesized by the reaction of 2,1,3-benzothiadiazole ...

Compound Q&A

What industries use 2,1,3-Benzothiadiazole-4-sulfonyl chloride (CAS: 73713-79-8)?

2,1,3-Benzothiadiazole-4-sulfonyl chloride finds applications in pharmaceuticals for its potential a...

Compound Q&A

What precautions should be taken when handling 2,1,3-Benzothiadiazole-4-sulfonyl chloride (CAS: 73713-79-8)?

Proper handling of 2,1,3-Benzothiadiazole-4-sulfonyl chloride requires the use of personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...